CAS 1820717-50-7 is the registry number for 7-chloro-5-nitro-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-chloro-5-nitro-1,3-benzoxazol-2-amine (CAS 1820717-50-7) is a chemical compound with the molecular formula C7H4ClN3O3 and a molecular weight of 213.58 g/mol. IUPAC name: 7-chloro-5-nitro-1,3-benzoxazol-2-amine. InChIKey: RVZMLKNBVLXHIR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O3 |
|---|---|
| Molecular weight | 213.58 g/mol |
| IUPAC name | 7-chloro-5-nitro-1,3-benzoxazol-2-amine |
| InChIKey | RVZMLKNBVLXHIR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(O2)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)