CAS 1326814-89-4 appears in our catalog under these names: 5-Chloro-7-nitro-1,3-benzoxazol-2-amine, 98%, 5-Chloro-7-nitrobenzo(d)oxazol-2-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g.
5-chloro-7-nitro-1,3-benzoxazol-2-amine (CAS 1326814-89-4) is a chemical compound with the molecular formula C7H4ClN3O3 and a molecular weight of 213.58 g/mol. IUPAC name: 5-chloro-7-nitro-1,3-benzoxazol-2-amine. InChIKey: HIBJGONRFGFVHY-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O3 |
|---|---|
| Molecular weight | 213.58 g/mol |
| IUPAC name | 5-chloro-7-nitro-1,3-benzoxazol-2-amine |
| InChIKey | HIBJGONRFGFVHY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(O2)N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)