CAS 1326810-85-8 is the registry number for 5-Chloro-6-nitro-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-chloro-6-nitro-1,3-benzoxazol-2-amine (CAS 1326810-85-8) is a chemical compound with the molecular formula C7H4ClN3O3 and a molecular weight of 213.58 g/mol. IUPAC name: 5-chloro-6-nitro-1,3-benzoxazol-2-amine. InChIKey: AOHRVJXLCRFILU-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O3 |
|---|---|
| Molecular weight | 213.58 g/mol |
| IUPAC name | 5-chloro-6-nitro-1,3-benzoxazol-2-amine |
| InChIKey | AOHRVJXLCRFILU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)[N+](=O)[O-])OC(=N2)N |
Computed by PubChem (NCBI)