CAS 1820735-92-9 is the registry number for methyl 2-{3-[4-(trifluoromethoxy)phenyl]phenyl}acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[3-[4-(trifluoromethoxy)phenyl]phenyl]acetate (CAS 1820735-92-9) is a chemical compound with the molecular formula C16H13F3O3 and a molecular weight of 310.27 g/mol. IUPAC name: methyl 2-[3-[4-(trifluoromethoxy)phenyl]phenyl]acetate. InChIKey: GYNYLGXCVXHBQK-UHFFFAOYSA-N.
| Molecular formula | C16H13F3O3 |
|---|---|
| Molecular weight | 310.27 g/mol |
| IUPAC name | methyl 2-[3-[4-(trifluoromethoxy)phenyl]phenyl]acetate |
| InChIKey | GYNYLGXCVXHBQK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC=C1)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)