CAS 400878-05-9 appears in our catalog under these names: 4-Methoxy-3-([3-(trifluoromethyl)phenoxy]methyl)benzaldehyde, 95%, 4-Methoxy-3-{(3-(trifluoromethyl)phenoxy)-methyl}benzaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]benzaldehyde (CAS 400878-05-9) is a chemical compound with the molecular formula C16H13F3O3 and a molecular weight of 310.27 g/mol. IUPAC name: 4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]benzaldehyde. InChIKey: WKJZHVKGLHYSKI-UHFFFAOYSA-N.
| Molecular formula | C16H13F3O3 |
|---|---|
| Molecular weight | 310.27 g/mol |
| IUPAC name | 4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]benzaldehyde |
| InChIKey | WKJZHVKGLHYSKI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=O)COC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)