Products 1820747-56-5

CAS 1820747-56-5 is the registry number for 3-Bromo-5-fluoro-2-methoxyaniline hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-bromo-5-fluoro-2-methoxyaniline;hydrochloride (CAS 1820747-56-5) is a chemical compound with the molecular formula C7H8BrClFNO and a molecular weight of 256.50 g/mol. IUPAC name: 3-bromo-5-fluoro-2-methoxyaniline;hydrochloride. InChIKey: TVPUTJVNIWZNDO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BrClFNO
Molecular weight256.50 g/mol
IUPAC name3-bromo-5-fluoro-2-methoxyaniline;hydrochloride
InChIKeyTVPUTJVNIWZNDO-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1Br)F)N.Cl

Computed by PubChem (NCBI)