Products 2940940-81-6
CAS 2940940-81-6 is the registry number for 2-(aminomethyl)-4-chloro-3-fluoro-phenol,hydrobromide, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
2-(aminomethyl)-4-chloro-3-fluorophenol;hydrobromide (CAS 2940940-81-6) is a chemical compound with the molecular formula C7H8BrClFNO and a molecular weight of 256.50 g/mol. IUPAC name: 2-(aminomethyl)-4-chloro-3-fluorophenol;hydrobromide. InChIKey: RJCGEVQQOKFZOF-UHFFFAOYSA-N.
| Molecular formula | C7H8BrClFNO |
|---|---|
| Molecular weight | 256.50 g/mol |
| IUPAC name | 2-(aminomethyl)-4-chloro-3-fluorophenol;hydrobromide |
| InChIKey | RJCGEVQQOKFZOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)CN)F)Cl.Br |
Computed by PubChem (NCBI)