CAS 1820934-93-7 appears in our catalog under these names: GlyT1 Inhibitor 1, Glyt1 inhibitor 1, GlyT1 Inhibitor 1, 98.59%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 2mg, 10mM/1mL, 100 mg.
3-[2-(2-methyl-4-pyridinyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carbonyl]-4-propan-2-yloxybenzonitrile (CAS 1820934-93-7) is a chemical compound with the molecular formula C22H21N5O2 and a molecular weight of 387.4 g/mol. IUPAC name: 3-[2-(2-methyl-4-pyridinyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carbonyl]-4-propan-2-yloxybenzonitrile. InChIKey: CIEHAYBWEMOJMN-UHFFFAOYSA-N.
| Molecular formula | C22H21N5O2 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 3-[2-(2-methyl-4-pyridinyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carbonyl]-4-propan-2-yloxybenzonitrile |
| InChIKey | CIEHAYBWEMOJMN-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)N2C=C3CN(CC3=N2)C(=O)C4=C(C=CC(=C4)C#N)OC(C)C |
Computed by PubChem (NCBI)