Products 2215927-89-0
CAS 2215927-89-0 is the registry number for ERK-MYD88 interaction inhibitor 1, 99.02%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg, 50 mg.
2-[4-(dimethylamino)phenyl]-N-(6-methoxy-3-pyridinyl)-3H-benzimidazole-5-carboxamide (CAS 2215927-89-0) is a chemical compound with the molecular formula C22H21N5O2 and a molecular weight of 387.4 g/mol. IUPAC name: 2-[4-(dimethylamino)phenyl]-N-(6-methoxy-3-pyridinyl)-3H-benzimidazole-5-carboxamide. InChIKey: KNOQKFKILLZESZ-UHFFFAOYSA-N.
| Molecular formula | C22H21N5O2 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 2-[4-(dimethylamino)phenyl]-N-(6-methoxy-3-pyridinyl)-3H-benzimidazole-5-carboxamide |
| InChIKey | KNOQKFKILLZESZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=C3)C(=O)NC4=CN=C(C=C4)OC |
Computed by PubChem (NCBI)
Synonyms:
ERK-MYD88 interaction inhibitor 1, orb2665397