CAS 1820937-65-2 is the registry number for tert-Butyl 7,7-dimethyl-6,7-dihydro-2H-pyrazolo(4,3-c)pyridine-5(4H)-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 7,7-dimethyl-4,6-dihydro-1H-pyrazolo[4,5-c]pyridine-5-carboxylate (CAS 1820937-65-2) is a chemical compound with the molecular formula C13H21N3O2 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl 7,7-dimethyl-4,6-dihydro-1H-pyrazolo[4,5-c]pyridine-5-carboxylate. InChIKey: KTJZXUZVDHAVAI-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O2 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl 7,7-dimethyl-4,6-dihydro-1H-pyrazolo[4,5-c]pyridine-5-carboxylate |
| InChIKey | KTJZXUZVDHAVAI-UHFFFAOYSA-N |
| SMILES | CC1(CN(CC2=C1NN=C2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)