CAS 1821027-56-8 is the registry number for Methyl 4–acetyl–3–fluorothiophene–2–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Methyl 4-acetyl-3-fluorothiophene-2-carboxylate (CAS 1821027-56-8) is a chemical compound with the molecular formula C8H7FO3S and a molecular weight of 202.20 g/mol. IUPAC name: methyl 4-acetyl-3-fluorothiophene-2-carboxylate. InChIKey: PVEUHGYHTJCJHT-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3S |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | methyl 4-acetyl-3-fluorothiophene-2-carboxylate |
| InChIKey | PVEUHGYHTJCJHT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CSC(=C1F)C(=O)OC |
Computed by PubChem (NCBI)