Products 455-25-4
CAS 455-25-4 appears in our catalog under these names: 4-Acetylbenzene-1-sulfonyl fluoride, 4-Acetylbenzene-1-sulfonyl fluoride 95%, 4-Acetylbenzene-1-sulfonyl fluoride, 97%, 4-Acetylbenzene-1-sulfonyl fluoride, 95%, 95%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 50mg, 500mg, 2.5g.
4-acetylbenzenesulfonyl fluoride (CAS 455-25-4) is a chemical compound with the molecular formula C8H7FO3S and a molecular weight of 202.20 g/mol. IUPAC name: 4-acetylbenzenesulfonyl fluoride. InChIKey: GCMYDSDIXNHNKU-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3S |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | 4-acetylbenzenesulfonyl fluoride |
| InChIKey | GCMYDSDIXNHNKU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)