CAS 182120-91-8 is the registry number for 2-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1,3-oxazole-4-carboxylic acid (CAS 182120-91-8) is a chemical compound with the molecular formula C20H16N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: 2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1,3-oxazole-4-carboxylic acid. InChIKey: ZCGYFLSCIKFVTH-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | ZCGYFLSCIKFVTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=NC(=CO4)C(=O)O |
Computed by PubChem (NCBI)