CAS 503469-95-2 appears in our catalog under these names: 5-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)-1,2-oxazole-3-carboxylic acid, 5-[N-Fmocmethyl]-1,2-oxazole-3-carboxylic acid 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1,2-oxazole-3-carboxylic acid (CAS 503469-95-2) is a chemical compound with the molecular formula C20H16N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1,2-oxazole-3-carboxylic acid. InChIKey: SAGUQGULXZQQMU-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-1,2-oxazole-3-carboxylic acid |
| InChIKey | SAGUQGULXZQQMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC(=NO4)C(=O)O |
Computed by PubChem (NCBI)