Products 1821202-05-4
CAS 1821202-05-4 is the registry number for 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-2,3-DIHYDRO-1H-INDEN-1-OL, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-ol (CAS 1821202-05-4) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-ol. InChIKey: KNFXDCCWYBWNGA-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-ol |
| InChIKey | KNFXDCCWYBWNGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CCC(C3=CC=C2)O |
Computed by PubChem (NCBI)