CAS 1821666-71-0 appears in our catalog under these names: Pazopanib Impurity 43, N4-(2,3-Dimethyl-2H-indazol-6-yl)-N4-methyl-2,4-pyrimidinediamine, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-N-(2,3-dimethylindazol-6-yl)-4-N-methylpyrimidine-2,4-diamine (CAS 1821666-71-0) is a chemical compound with the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. IUPAC name: 4-N-(2,3-dimethylindazol-6-yl)-4-N-methylpyrimidine-2,4-diamine. InChIKey: GGALKBHEAIMTPY-UHFFFAOYSA-N.
| Molecular formula | C14H16N6 |
|---|---|
| Molecular weight | 268.32 g/mol |
| IUPAC name | 4-N-(2,3-dimethylindazol-6-yl)-4-N-methylpyrimidine-2,4-diamine |
| InChIKey | GGALKBHEAIMTPY-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=NN1C)N(C)C3=NC(=NC=C3)N |
Computed by PubChem (NCBI)