CAS 30169-25-6 appears in our catalog under these names: 3,6-Bis(3,5-dimethyl-1H-pyrazol-1-yl)-1,2,4,5-tetrazine, >95% (HPLC), 3,6–Bis(3,5–dimethyl–1H–pyrazol–1–yl)–1,2,4,5–tetrazine, 3,6-Bis(3,5-dimethyl-1H-pyrazol-1-yl)-1,2,4,5-tetrazine, 3,6-Bis(3,5-dimethyl-1H-pyrazol-1-yl)-1,2,4,5-tetrazine 97%, 3,6-Bis(3,5-dimethyl-1H-pyrazol-1-yl)-1,2,4,5-tetrazine, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 2,5g, 100g, 500g.
3,6-bis(2,4-dimethylpyrrol-1-yl)-1,2,4,5-tetrazine (CAS 30169-25-6) is a chemical compound with the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. IUPAC name: 3,6-bis(2,4-dimethylpyrrol-1-yl)-1,2,4,5-tetrazine. InChIKey: MCBFBEQRHJQQBF-UHFFFAOYSA-N.
| Molecular formula | C14H16N6 |
|---|---|
| Molecular weight | 268.32 g/mol |
| IUPAC name | 3,6-bis(2,4-dimethylpyrrol-1-yl)-1,2,4,5-tetrazine |
| InChIKey | MCBFBEQRHJQQBF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN1C2=NN=C(N=N2)N3C=C(C=C3C)C)C |
Computed by PubChem (NCBI)