Products 1821714-36-6
CAS 1821714-36-6 is the registry number for (1S,2S,4S)-Bicyclo[2.2.1]heptan-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S,4S)-bicyclo[2.2.1]heptan-2-amine (CAS 1821714-36-6) is a chemical compound with the molecular formula C7H13N and a molecular weight of 111.18 g/mol. IUPAC name: (1S,2S,4S)-bicyclo[2.2.1]heptan-2-amine. InChIKey: JEPPYVOSGKWVSJ-ACZMJKKPSA-N.
| Molecular formula | C7H13N |
|---|---|
| Molecular weight | 111.18 g/mol |
| IUPAC name | (1S,2S,4S)-bicyclo[2.2.1]heptan-2-amine |
| InChIKey | JEPPYVOSGKWVSJ-ACZMJKKPSA-N |
| SMILES | C1C[C@H]2C[C@H]1C[C@@H]2N |
Computed by PubChem (NCBI)