CAS 84235-33-6 is the registry number for (+)(1S,2S,4R)-Bicyclo(2.2.1)heptane-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 2g, 5g, 10g.
(1S,2S,4R)-bicyclo[2.2.1]heptan-2-amine (CAS 84235-33-6) is a chemical compound with the molecular formula C7H13N and a molecular weight of 111.18 g/mol. IUPAC name: (1S,2S,4R)-bicyclo[2.2.1]heptan-2-amine. InChIKey: JEPPYVOSGKWVSJ-VQVTYTSYSA-N.
| Molecular formula | C7H13N |
|---|---|
| Molecular weight | 111.18 g/mol |
| IUPAC name | (1S,2S,4R)-bicyclo[2.2.1]heptan-2-amine |
| InChIKey | JEPPYVOSGKWVSJ-VQVTYTSYSA-N |
| SMILES | C1C[C@H]2C[C@@H]1C[C@@H]2N |
Computed by PubChem (NCBI)