CAS 1821717-21-8 is the registry number for Tofacitinib Impurity 201. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate (CAS 1821717-21-8) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: methyl N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate. InChIKey: PKLKJOHNINGLAQ-RQJHMYQMSA-N.
| Molecular formula | C8H16N2O2 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | methyl N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate |
| InChIKey | PKLKJOHNINGLAQ-RQJHMYQMSA-N |
| SMILES | C[C@@H]1CCNC[C@@H]1NC(=O)OC |
Computed by PubChem (NCBI)