Products 1821717-21-8

CAS 1821717-21-8 is the registry number for Tofacitinib Impurity 201. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Methyl N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate (CAS 1821717-21-8) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: methyl N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate. InChIKey: PKLKJOHNINGLAQ-RQJHMYQMSA-N.

Identity
Molecular formulaC8H16N2O2
Molecular weight172.22 g/mol
IUPAC namemethyl N-[(3R,4R)-4-methylpiperidin-3-yl]carbamate
InChIKeyPKLKJOHNINGLAQ-RQJHMYQMSA-N
SMILESC[C@@H]1CCNC[C@@H]1NC(=O)OC

Computed by PubChem (NCBI)