Products 1821736-63-3
CAS 1821736-63-3 is the registry number for (1R,5S)-3-(3-Chloro-4-methylphenyl)-8-azabicyclo[3.2.1]octane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5S)-3-(3-chloro-4-methylphenyl)-8-azabicyclo[3.2.1]octane (CAS 1821736-63-3) is a chemical compound with the molecular formula C14H18ClN and a molecular weight of 235.75 g/mol. IUPAC name: (1R,5S)-3-(3-chloro-4-methylphenyl)-8-azabicyclo[3.2.1]octane. InChIKey: MMOFCWJLARITDZ-YHWZYXNKSA-N.
| Molecular formula | C14H18ClN |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | (1R,5S)-3-(3-chloro-4-methylphenyl)-8-azabicyclo[3.2.1]octane |
| InChIKey | MMOFCWJLARITDZ-YHWZYXNKSA-N |
| SMILES | CC1=C(C=C(C=C1)C2C[C@H]3CC[C@@H](C2)N3)Cl |
Computed by PubChem (NCBI)