CAS 351490-95-4 appears in our catalog under these names: 2-Methyl-1-(naphthalen-2-yl)propan-2-amine hydrochloride, 95+%, 2–(2–Methyl–2–aminopropyl)naphthalene hydrochloride. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-methyl-1-naphthalen-2-ylpropan-2-amine;hydrochloride (CAS 351490-95-4) is a chemical compound with the molecular formula C14H18ClN and a molecular weight of 235.75 g/mol. IUPAC name: 2-methyl-1-naphthalen-2-ylpropan-2-amine;hydrochloride. InChIKey: ORVVZYBFFPBNBJ-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | 2-methyl-1-naphthalen-2-ylpropan-2-amine;hydrochloride |
| InChIKey | ORVVZYBFFPBNBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC2=CC=CC=C2C=C1)N.Cl |
Computed by PubChem (NCBI)