CAS 1821774-86-0 appears in our catalog under these names: (2R,6R)-2,6-Dimethyl-4-oxo-piperidine-1-carboxylic acid t-butyl ester, (2R,6R)-tert-Butyl 2,6-dimethyl-4-oxopiperidine-1-carboxylate, 98%, 98%, (2R,6R)-tert-Butyl 2,6-dimethyl-4-oxopiperidine-1-carboxylate, 98%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 100mg, 250mg, 1g.
Tert-butyl (2R,6R)-2,6-dimethyl-4-oxopiperidine-1-carboxylate (CAS 1821774-86-0) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (2R,6R)-2,6-dimethyl-4-oxopiperidine-1-carboxylate. InChIKey: ADBYGASBXODWTQ-RKDXNWHRSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (2R,6R)-2,6-dimethyl-4-oxopiperidine-1-carboxylate |
| InChIKey | ADBYGASBXODWTQ-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CC(=O)C[C@H](N1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)