Products 1821783-96-3
CAS 1821783-96-3 appears in our catalog under these names: (Cis–2–methylpyrrolidin–3–yl)methanol hydrochloride, Cis-(2-methylpyrrolidin-3-yl)methanol hydrochloride, 95%, (Cis-2-methylpyrrolidin-3-yl)methanol hydrochloride, 97%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 250mg, 50mg, 100mg, 1g.
[(2R,3R)-2-methylpyrrolidin-3-yl]methanol;hydrochloride (CAS 1821783-96-3) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: [(2R,3R)-2-methylpyrrolidin-3-yl]methanol;hydrochloride. InChIKey: UPPSCPSGLCWAQT-IBTYICNHSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | [(2R,3R)-2-methylpyrrolidin-3-yl]methanol;hydrochloride |
| InChIKey | UPPSCPSGLCWAQT-IBTYICNHSA-N |
| SMILES | C[C@@H]1[C@@H](CCN1)CO.Cl |
Computed by PubChem (NCBI)