Products 1821798-97-3
CAS 1821798-97-3 is the registry number for (2R,5S)-2,5-Diaminohexanoate. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,5S)-2,5-diaminohexanoic acid is a diamino acid that is hexanoic acid carrying two amino substituents at positions 2 and 5 (the 2R,5S-diastereomer). It is functionally related to a D-norleucine. It is a conjugate base of a (2R,5S)-2,5-diammoniohexanoate.
Source: ChEBI
| Molecular formula | C6H14N2O2 |
|---|---|
| Molecular weight | 146.19 g/mol |
| IUPAC name | (2R,5S)-2,5-diaminohexanoic acid |
| InChIKey | CEVCRLBFUJAKOG-CRCLSJGQSA-N |
| SMILES | C[C@@H](CC[C@H](C(=O)O)N)N |
Computed by PubChem (NCBI)