CAS 1821818-97-6 is the registry number for tert–Butyl ((1R,3S)–3–hydroxy–2,2–dimethylcyclobutyl)carbamate. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl N-[(1R,3S)-3-hydroxy-2,2-dimethylcyclobutyl]carbamate (CAS 1821818-97-6) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-hydroxy-2,2-dimethylcyclobutyl]carbamate. InChIKey: XSSLOTCOOFGGJW-SFYZADRCSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-hydroxy-2,2-dimethylcyclobutyl]carbamate |
| InChIKey | XSSLOTCOOFGGJW-SFYZADRCSA-N |
| SMILES | CC1([C@@H](C[C@@H]1O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)