CAS 1821824-65-0 is the registry number for tert-Butyl ((1S,3S)-3-hydroxy-2,2-dimethylcyclobutyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1S,3S)-3-hydroxy-2,2-dimethylcyclobutyl]carbamate (CAS 1821824-65-0) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-[(1S,3S)-3-hydroxy-2,2-dimethylcyclobutyl]carbamate. InChIKey: XSSLOTCOOFGGJW-YUMQZZPRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-[(1S,3S)-3-hydroxy-2,2-dimethylcyclobutyl]carbamate |
| InChIKey | XSSLOTCOOFGGJW-YUMQZZPRSA-N |
| SMILES | CC1([C@H](C[C@@H]1O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)