CAS 1822341-34-3 is the registry number for Methyl 2-amino-2-(3-bromo-2-fluorophenyl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-amino-2-(3-bromo-2-fluorophenyl)acetate (CAS 1822341-34-3) is a chemical compound with the molecular formula C9H9BrFNO2 and a molecular weight of 262.08 g/mol. IUPAC name: methyl 2-amino-2-(3-bromo-2-fluorophenyl)acetate. InChIKey: QTQSZMAOIXAMGQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | methyl 2-amino-2-(3-bromo-2-fluorophenyl)acetate |
| InChIKey | QTQSZMAOIXAMGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C(=CC=C1)Br)F)N |
Computed by PubChem (NCBI)