Products 1822506-78-4
CAS 1822506-78-4 appears in our catalog under these names: 3-(4-Cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoic acid, 98%, 3-(4-Cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoic acid, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-(4-cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoic acid (CAS 1822506-78-4) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 3-(4-cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoic acid. InChIKey: HNQIMWBFGBZFPS-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 3-(4-cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoic acid |
| InChIKey | HNQIMWBFGBZFPS-UHFFFAOYSA-N |
| SMILES | C1CC1C2(C(=O)NC(=O)N2)CCC(=O)O |
Computed by PubChem (NCBI)