CAS 1822544-80-8 is the registry number for α-​(((1,​1-​Dimethylethoxy)​carbonyl)​amino)​tetrahydro-​2H-​thiopyran-​4-​acetic acid 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1,1-dioxothian-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1822544-80-8) is a chemical compound with the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. IUPAC name: 2-(1,1-dioxothian-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: GDQPKCZYHYRQCH-UHFFFAOYSA-N.
| Molecular formula | C12H21NO6S |
|---|---|
| Molecular weight | 307.37 g/mol |
| IUPAC name | 2-(1,1-dioxothian-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | GDQPKCZYHYRQCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1CCS(=O)(=O)CC1)C(=O)O |
Computed by PubChem (NCBI)