CAS 2171573-47-8 is the registry number for 2-{((tert-Butoxy)carbonyl)amino}-3-(1,1-dioxo-1λ6-thiolan-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(1,1-dioxothiolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2171573-47-8) is a chemical compound with the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. IUPAC name: 3-(1,1-dioxothiolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DXOKNUCSHKQCCV-UHFFFAOYSA-N.
| Molecular formula | C12H21NO6S |
|---|---|
| Molecular weight | 307.37 g/mol |
| IUPAC name | 3-(1,1-dioxothiolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DXOKNUCSHKQCCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1CCS(=O)(=O)C1)C(=O)O |
Computed by PubChem (NCBI)