Products 1822553-28-5

CAS 1822553-28-5 is the registry number for Methyl alaninate 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 1,1-dioxothiazetidine-3-carboxylate (CAS 1822553-28-5) is a chemical compound with the molecular formula C4H7NO4S and a molecular weight of 165.17 g/mol. IUPAC name: methyl 1,1-dioxothiazetidine-3-carboxylate. InChIKey: MBYZHIKXDPJMMU-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7NO4S
Molecular weight165.17 g/mol
IUPAC namemethyl 1,1-dioxothiazetidine-3-carboxylate
InChIKeyMBYZHIKXDPJMMU-UHFFFAOYSA-N
SMILESCOC(=O)C1CS(=O)(=O)N1

Computed by PubChem (NCBI)