Products 1871991-60-4

CAS 1871991-60-4 is the registry number for 2-​((Dimethyloxido-​λ4-​sulfanylidene)​amino)​-​2-​oxo-acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]-2-oxoacetic acid (CAS 1871991-60-4) is a chemical compound with the molecular formula C4H7NO4S and a molecular weight of 165.17 g/mol. IUPAC name: 2-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]-2-oxoacetic acid. InChIKey: LWUGZXBOJVAMML-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7NO4S
Molecular weight165.17 g/mol
IUPAC name2-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]-2-oxoacetic acid
InChIKeyLWUGZXBOJVAMML-UHFFFAOYSA-N
SMILESCS(=NC(=O)C(=O)O)(=O)C

Computed by PubChem (NCBI)