Products 1822593-18-9
CAS 1822593-18-9 is the registry number for tert-Butyl 1-amino-1-oxobut-3-en-2-ylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl N-(1-amino-1-oxobut-3-en-2-yl)carbamate (CAS 1822593-18-9) is a chemical compound with the molecular formula C9H16N2O3 and a molecular weight of 200.23 g/mol. IUPAC name: tert-butyl N-(1-amino-1-oxobut-3-en-2-yl)carbamate. InChIKey: LQMSWYOAOSGWNN-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O3 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | tert-butyl N-(1-amino-1-oxobut-3-en-2-yl)carbamate |
| InChIKey | LQMSWYOAOSGWNN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C=C)C(=O)N |
Computed by PubChem (NCBI)