CAS 878132-19-5 appears in our catalog under these names: 1-Ethyl-3-methylimidazolium l-(+)-lactate, 95%, 1–Ethyl–3–methylimidazolium L–(+)–lactate, 1-ETHYL-3-METHYLIMIDAZOLIUM L-(+)-LACTAT, 1-ETHYL-3-METHYLIMIDAZOLIUM L-LACTATE, 95%+(NMR),RG, 95%+(NMR),RG. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 50g, 100g, 25g, 1g.
1-ethyl-3-methylimidazol-3-ium;(2S)-2-hydroxypropanoate (CAS 878132-19-5) is a chemical compound with the molecular formula C9H16N2O3 and a molecular weight of 200.23 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;(2S)-2-hydroxypropanoate. InChIKey: RJCLZEKYUQKDAL-WNQIDUERSA-M.
| Molecular formula | C9H16N2O3 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;(2S)-2-hydroxypropanoate |
| InChIKey | RJCLZEKYUQKDAL-WNQIDUERSA-M |
| SMILES | CCN1C=C[N+](=C1)C.C[C@@H](C(=O)[O-])O |
Computed by PubChem (NCBI)