Products 1822660-17-2
CAS 1822660-17-2 is the registry number for methyl(2-methyl-5-(trifluoromethyl)phenyl)sulfane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-methyl-2-methylsulfanyl-4-(trifluoromethyl)benzene (CAS 1822660-17-2) is a chemical compound with the molecular formula C9H9F3S and a molecular weight of 206.23 g/mol. IUPAC name: 1-methyl-2-methylsulfanyl-4-(trifluoromethyl)benzene. InChIKey: PMJCTKMTLDDYIW-UHFFFAOYSA-N.
| Molecular formula | C9H9F3S |
|---|---|
| Molecular weight | 206.23 g/mol |
| IUPAC name | 1-methyl-2-methylsulfanyl-4-(trifluoromethyl)benzene |
| InChIKey | PMJCTKMTLDDYIW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(F)(F)F)SC |
Computed by PubChem (NCBI)