Products 77745-03-0

CAS 77745-03-0 is the registry number for Benzyl 2,2,2-trifluoroethyl sulfide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroethylsulfanylmethylbenzene (CAS 77745-03-0) is a chemical compound with the molecular formula C9H9F3S and a molecular weight of 206.23 g/mol. IUPAC name: 2,2,2-trifluoroethylsulfanylmethylbenzene. InChIKey: ZDVBYNCJCIYCFO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9F3S
Molecular weight206.23 g/mol
IUPAC name2,2,2-trifluoroethylsulfanylmethylbenzene
InChIKeyZDVBYNCJCIYCFO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CSCC(F)(F)F

Computed by PubChem (NCBI)