CAS 1822851-50-2 is the registry number for 2-Fluoro-3-iodo-4-methoxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Methyl 2-fluoro-3-iodo-4-methoxybenzoate (CAS 1822851-50-2) is a chemical compound with the molecular formula C9H8FIO3 and a molecular weight of 310.06 g/mol. IUPAC name: methyl 2-fluoro-3-iodo-4-methoxybenzoate. InChIKey: OGNQQVGEYSTMKW-UHFFFAOYSA-N.
| Molecular formula | C9H8FIO3 |
|---|---|
| Molecular weight | 310.06 g/mol |
| IUPAC name | methyl 2-fluoro-3-iodo-4-methoxybenzoate |
| InChIKey | OGNQQVGEYSTMKW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)OC)F)I |
Computed by PubChem (NCBI)