Products 1823590-32-4

CAS 1823590-32-4 is the registry number for 2-Fluoro-5-iodo-4-methoxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-fluoro-5-iodo-4-methoxybenzoate (CAS 1823590-32-4) is a chemical compound with the molecular formula C9H8FIO3 and a molecular weight of 310.06 g/mol. IUPAC name: methyl 2-fluoro-5-iodo-4-methoxybenzoate. InChIKey: AQXOJVZCCFPLBI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8FIO3
Molecular weight310.06 g/mol
IUPAC namemethyl 2-fluoro-5-iodo-4-methoxybenzoate
InChIKeyAQXOJVZCCFPLBI-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)F)C(=O)OC)I

Computed by PubChem (NCBI)