CAS 182287-46-3 is the registry number for 2-(((tert-Butoxy)carbonyl)amino)-3-(trimethylsilyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilylpropanoic acid (CAS 182287-46-3) is a chemical compound with the molecular formula C11H23NO4Si and a molecular weight of 261.39 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilylpropanoic acid. InChIKey: LMFSUXXQTKCGGW-UHFFFAOYSA-N.
| Molecular formula | C11H23NO4Si |
|---|---|
| Molecular weight | 261.39 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilylpropanoic acid |
| InChIKey | LMFSUXXQTKCGGW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C[Si](C)(C)C)C(=O)O |
Computed by PubChem (NCBI)