Products 2504201-63-0

CAS 2504201-63-0 is the registry number for 5-(((2-(Trimethylsilyl)ethoxy)carbonyl)amino)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-(2-trimethylsilylethoxycarbonylamino)pentanoic acid (CAS 2504201-63-0) is a chemical compound with the molecular formula C11H23NO4Si and a molecular weight of 261.39 g/mol. IUPAC name: 5-(2-trimethylsilylethoxycarbonylamino)pentanoic acid. InChIKey: ILNKYUDFUSTLGG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23NO4Si
Molecular weight261.39 g/mol
IUPAC name5-(2-trimethylsilylethoxycarbonylamino)pentanoic acid
InChIKeyILNKYUDFUSTLGG-UHFFFAOYSA-N
SMILESC[Si](C)(C)CCOC(=O)NCCCCC(=O)O

Computed by PubChem (NCBI)