CAS 182291-66-3 appears in our catalog under these names: 3–(Adamantan–1–yl)–2–aminopropanoic acid hydrochloride, 3-(Adamantan-1-yl)-2-aminopropanoic acid hydrochloride, 95%, 3-(Adamantan-1-yl)-2-aminopropanoic acid hydrochloride, 98+%, 3-(Adamantan-1-yl)-2-aminopropanoic acid hydrochloride, 97%, 97%. Offered by: GLPBio, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride (CAS 182291-66-3) is a chemical compound with the molecular formula C13H22ClNO2 and a molecular weight of 259.77 g/mol. IUPAC name: 3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride. InChIKey: NSPGPACVPPNYAP-UHFFFAOYSA-N.
| Molecular formula | C13H22ClNO2 |
|---|---|
| Molecular weight | 259.77 g/mol |
| IUPAC name | 3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride |
| InChIKey | NSPGPACVPPNYAP-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)