Products 70893-38-8

CAS 70893-38-8 is the registry number for 1-adamantyl-L-alanine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride (CAS 70893-38-8) is a chemical compound with the molecular formula C13H22ClNO2 and a molecular weight of 259.77 g/mol. IUPAC name: (2S)-3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride. InChIKey: NSPGPACVPPNYAP-ZKAIAUGBSA-N.

Identity
Molecular formulaC13H22ClNO2
Molecular weight259.77 g/mol
IUPAC name(2S)-3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride
InChIKeyNSPGPACVPPNYAP-ZKAIAUGBSA-N
SMILESC1C2CC3CC1CC(C2)(C3)C[C@@H](C(=O)O)N.Cl

Computed by PubChem (NCBI)