CAS 70893-38-8 is the registry number for 1-adamantyl-L-alanine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride (CAS 70893-38-8) is a chemical compound with the molecular formula C13H22ClNO2 and a molecular weight of 259.77 g/mol. IUPAC name: (2S)-3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride. InChIKey: NSPGPACVPPNYAP-ZKAIAUGBSA-N.
| Molecular formula | C13H22ClNO2 |
|---|---|
| Molecular weight | 259.77 g/mol |
| IUPAC name | (2S)-3-(1-adamantyl)-2-aminopropanoic acid;hydrochloride |
| InChIKey | NSPGPACVPPNYAP-ZKAIAUGBSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)