Products 182291-98-1
CAS 182291-98-1 appears in our catalog under these names: 4-(Aminomethyl)-3-methoxybenzonitrile hydrochloride, 4-(aminomethyl)-3-methoxybenzonitrile hydrochloride, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
4-(aminomethyl)-3-methoxybenzonitrile;hydrochloride (CAS 182291-98-1) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 4-(aminomethyl)-3-methoxybenzonitrile;hydrochloride. InChIKey: DQBMCBSCWDMFJH-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 4-(aminomethyl)-3-methoxybenzonitrile;hydrochloride |
| InChIKey | DQBMCBSCWDMFJH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C#N)CN.Cl |
Computed by PubChem (NCBI)