CAS 1823069-20-0 is the registry number for 5-Fluoro-2,3,4-trichlorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2,3,4-trichloro-5-fluorobenzamide (CAS 1823069-20-0) is a chemical compound with the molecular formula C7H3Cl3FNO and a molecular weight of 242.5 g/mol. IUPAC name: 2,3,4-trichloro-5-fluorobenzamide. InChIKey: RYCDBJLDARFIGH-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3FNO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2,3,4-trichloro-5-fluorobenzamide |
| InChIKey | RYCDBJLDARFIGH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)