CAS 2969397-36-0 is the registry number for 2-fluoro-1-(2,3,5-trichloropyridin-4-yl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-fluoro-1-(2,3,5-trichloro-4-pyridinyl)ethanone (CAS 2969397-36-0) is a chemical compound with the molecular formula C7H3Cl3FNO and a molecular weight of 242.5 g/mol. IUPAC name: 2-fluoro-1-(2,3,5-trichloro-4-pyridinyl)ethanone. InChIKey: HHWNJOXSRQPIMV-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3FNO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-fluoro-1-(2,3,5-trichloro-4-pyridinyl)ethanone |
| InChIKey | HHWNJOXSRQPIMV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)Cl)C(=O)CF)Cl |
Computed by PubChem (NCBI)