CAS 1823244-46-7 is the registry number for 1,6-Di-tert-butyl indole-1,6-dicarboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ditert-butyl indole-1,6-dicarboxylate (CAS 1823244-46-7) is a chemical compound with the molecular formula C18H23NO4 and a molecular weight of 317.4 g/mol. IUPAC name: ditert-butyl indole-1,6-dicarboxylate. InChIKey: NPIWLTCOPPSOQP-UHFFFAOYSA-N.
| Molecular formula | C18H23NO4 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | ditert-butyl indole-1,6-dicarboxylate |
| InChIKey | NPIWLTCOPPSOQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC2=C(C=C1)C=CN2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)