CAS 147610-84-2 appears in our catalog under these names: 6-Benzyl 1-ethyl 6-azaspiro[2.5]octane-1,6-dicarboxylate, 95%, 6-Benzyl 1-ethyl 6-azaspiro(2.5)octane-1,6-dicarboxylate, 97%, 6-benzyl 1-ethyl 6-azaspiro[2.5]octane-1,6-dicarboxylate, 96%, 96%, 6-BENZYL 1-ETHYL 6-AZASPIRO[2.5]OCTANE-1,6-DICARBOXYLATE, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 500mg.
6-O-benzyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate (CAS 147610-84-2) is a chemical compound with the molecular formula C18H23NO4 and a molecular weight of 317.4 g/mol. IUPAC name: 6-O-benzyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate. InChIKey: HPESIWGAJLAFOB-UHFFFAOYSA-N.
| Molecular formula | C18H23NO4 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 6-O-benzyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate |
| InChIKey | HPESIWGAJLAFOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC12CCN(CC2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)