CAS 1823257-61-9 is the registry number for 2-(1-(tert-Butoxycarbonyl)-3,3-difluoro-1,2,3,6-tetrahydropyridin-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]-2,6-dihydropyridin-4-yl]acetic acid (CAS 1823257-61-9) is a chemical compound with the molecular formula C12H17F2NO4 and a molecular weight of 277.26 g/mol. IUPAC name: 2-[3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]-2,6-dihydropyridin-4-yl]acetic acid. InChIKey: OKSUYZSMBQHYFA-UHFFFAOYSA-N.
| Molecular formula | C12H17F2NO4 |
|---|---|
| Molecular weight | 277.26 g/mol |
| IUPAC name | 2-[3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]-2,6-dihydropyridin-4-yl]acetic acid |
| InChIKey | OKSUYZSMBQHYFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=C(C(C1)(F)F)CC(=O)O |
Computed by PubChem (NCBI)