CAS 2225144-91-0 is the registry number for 5-(tert-Butoxycarbonyl)-1,1-difluoro-5-azaspiro(2.4)heptane-4-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,2-difluoro-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-4-carboxylic acid (CAS 2225144-91-0) is a chemical compound with the molecular formula C12H17F2NO4 and a molecular weight of 277.26 g/mol. IUPAC name: 2,2-difluoro-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-4-carboxylic acid. InChIKey: BOPBHLMJRYFQCU-UHFFFAOYSA-N.
| Molecular formula | C12H17F2NO4 |
|---|---|
| Molecular weight | 277.26 g/mol |
| IUPAC name | 2,2-difluoro-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-4-carboxylic acid |
| InChIKey | BOPBHLMJRYFQCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1C(=O)O)CC2(F)F |
Computed by PubChem (NCBI)